C10H17NO4S — CID 174754651
(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methyl sulfamate (PubChem CID 174754651) has the molecular formula C10H17NO4S and a molecular weight of 247.32 g/mol. Its IUPAC name is (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methyl sulfamate.
| Compound Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methyl sulfamate |
|---|---|
| PubChem CID | 174754651 |
| Molecular Formula | C10H17NO4S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methyl sulfamate |
| SMILES | CC1(C)C2CCC1(COS(N)(=O)=O)C(=O)C2 |
| InChI | InChI=1S/C10H17NO4S/c1-9(2)7-3-4-10(9,8(12)5-7)6-15-16(11,13)14/h7H,3-6H2,1-2H3,(H2,11,13,14) |
| InChIKey | WMKQAYNNGUDOOC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |