About [(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl sulfite
[(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl sulfite (PubChem CID 59434273) has the molecular formula C10H15O4S-
and a molecular weight of 231.29 g/mol. Its IUPAC name is [(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl sulfite.
Molecular Properties
| Compound Name | [(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl sulfite |
| PubChem CID | 59434273 |
| Molecular Formula | C10H15O4S- |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | [(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl sulfite |
| SMILES | CC1(C)C2CC[C@]1(COS(=O)[O-])C(=O)C2 |
| InChI | InChI=1S/C10H16O4S/c1-9(2)7-3-4-10(9,8(11)5-7)6-14-15(12)13/h7H,3-6H2,1-2H3,(H,12,13)/p-1/t7?,10-/m0/s1 |
| InChIKey | DCEOEBOPAUTYLU-MHPPCMCBSA-M |
| XLogP | 1.19 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl sulfite?
The IUPAC name of [(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl sulfite (CID 59434273) is [(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl sulfite.
What is the SMILES notation for [(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl sulfite?
The canonical SMILES for [(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl sulfite is CC1(C)C2CC[C@]1(COS(=O)[O-])C(=O)C2.
What is the InChIKey of [(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl sulfite?
The InChIKey is DCEOEBOPAUTYLU-MHPPCMCBSA-M. The full InChI is InChI=1S/C10H16O4S/c1-9(2)7-3-4-10(9,8(11)5-7)6-14-15(12)13/h7H,3-6H2,1-2H3,(H,12,13)/p-1/t7?,10-/m0/s1.
What are the key properties of [(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl sulfite?
[(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl sulfite has a molecular weight of 231.29 g/mol, XLogP of 1.19, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl sulfite is sourced from PubChem (CID 59434273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).