About CID 90772571
CID 90772571 (PubChem CID 90772571) has the molecular formula C10H15O4S
and a molecular weight of 231.29 g/mol.
Molecular Properties
| Compound Name | CID 90772571 |
| PubChem CID | 90772571 |
| Molecular Formula | C10H15O4S |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | — |
| SMILES | CC1(C)C2CCC1(COS([O])=O)C(=O)C2 |
| InChI | InChI=1S/C10H15O4S/c1-9(2)7-3-4-10(9,8(11)5-7)6-14-15(12)13/h7H,3-6H2,1-2H3 |
| InChIKey | HDXPEEPDYAVNGG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 63.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 90772571 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90772571?
The IUPAC name of CID 90772571 (CID 90772571) is not available.
What is the SMILES notation for CID 90772571?
The canonical SMILES for CID 90772571 is CC1(C)C2CCC1(COS([O])=O)C(=O)C2.
What is the InChIKey of CID 90772571?
The InChIKey is HDXPEEPDYAVNGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15O4S/c1-9(2)7-3-4-10(9,8(11)5-7)6-14-15(12)13/h7H,3-6H2,1-2H3.
What are the key properties of CID 90772571?
CID 90772571 has a molecular weight of 231.29 g/mol, XLogP of 1.41, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90772571 is sourced from PubChem (CID 90772571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).