C10H15O4S — CID 90772571
CID 90772571 (PubChem CID 90772571) has the molecular formula C10H15O4S and a molecular weight of 231.29 g/mol.
| Compound Name | CID 90772571 |
|---|---|
| PubChem CID | 90772571 |
| Molecular Formula | C10H15O4S |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | — |
| SMILES | CC1(C)C2CCC1(COS([O])=O)C(=O)C2 |
| InChI | InChI=1S/C10H15O4S/c1-9(2)7-3-4-10(9,8(11)5-7)6-14-15(12)13/h7H,3-6H2,1-2H3 |
| InChIKey | HDXPEEPDYAVNGG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 63.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |