C10H15O2S- — CID 58100465
7,7-dimethyl-1-(sulfenatomethyl)bicyclo[2.2.1]heptan-2-one (PubChem CID 58100465) has the molecular formula C10H15O2S- and a molecular weight of 199.29 g/mol. Its IUPAC name is 7,7-dimethyl-1-(sulfenatomethyl)bicyclo[2.2.1]heptan-2-one.
| Compound Name | 7,7-dimethyl-1-(sulfenatomethyl)bicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 58100465 |
| Molecular Formula | C10H15O2S- |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 7,7-dimethyl-1-(sulfenatomethyl)bicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)C2CCC1(CS[O-])C(=O)C2 |
| InChI | InChI=1S/C10H16O2S/c1-9(2)7-3-4-10(9,6-13-12)8(11)5-7/h7,12H,3-6H2,1-2H3/p-1 |
| InChIKey | FJBBLDYGUPCUDP-UHFFFAOYSA-M |
| XLogP | 2.25 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|