C14H25N2O4S- — CID 25085712
(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate;piperazine (PubChem CID 25085712) has the molecular formula C14H25N2O4S- and a molecular weight of 317.43 g/mol. Its IUPAC name is (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate;piperazine.
| Compound Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate;piperazine |
|---|---|
| PubChem CID | 25085712 |
| Molecular Formula | C14H25N2O4S- |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate;piperazine |
| SMILES | C1CNCCN1.CC1(C)C2CCC1(CS(=O)(=O)[O-])C(=O)C2 |
| InChI | InChI=1S/C10H16O4S.C4H10N2/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14;1-2-6-4-3-5-1/h7H,3-6H2,1-2H3,(H,12,13,14);5-6H,1-4H2/p-1 |
| InChIKey | JSAZTUYNZHDFNH-UHFFFAOYSA-M |
| XLogP | 0.11 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|