C16H19BrN2O4S — CID 71623114
2-bromobenzenediazonium;[(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonate (PubChem CID 71623114) has the molecular formula C16H19BrN2O4S and a molecular weight of 415.31 g/mol. Its IUPAC name is 2-bromobenzenediazonium;[(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonate.
| Compound Name | 2-bromobenzenediazonium;[(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonate |
|---|---|
| PubChem CID | 71623114 |
| Molecular Formula | C16H19BrN2O4S |
| Molecular Weight | 415.31 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | 2-bromobenzenediazonium;[(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonate |
| SMILES | CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)[O-])C(=O)C2.N#[N+]c1ccccc1Br |
| InChI | InChI=1S/C10H16O4S.C6H4BrN2/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14;7-5-3-1-2-4-6(5)9-8/h7H,3-6H2,1-2H3,(H,12,13,14);1-4H/q;+1/p-1/t7-,10-;/m0./s1 |
| InChIKey | GOJOPSFBMHLSJZ-YUWZRIFDSA-M |
| XLogP | 3.86 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|