C22H23F2IO4S — CID 23114451
bis(4-fluorophenyl)iodanium;(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate (PubChem CID 23114451) has the molecular formula C22H23F2IO4S and a molecular weight of 548.39 g/mol. Its IUPAC name is bis(4-fluorophenyl)iodanium;(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate.
| Compound Name | bis(4-fluorophenyl)iodanium;(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
|---|---|
| PubChem CID | 23114451 |
| Molecular Formula | C22H23F2IO4S |
| Molecular Weight | 548.39 g/mol |
| Exact Mass | 548.03 |
| IUPAC Name | bis(4-fluorophenyl)iodanium;(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)[O-])C(=O)C2.Fc1ccc([I+]c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C12H8F2I.C10H16O4S/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12;1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h1-8H;7H,3-6H2,1-2H3,(H,12,13,14)/q+1;/p-1 |
| InChIKey | YEADCVRKZWQDKZ-UHFFFAOYSA-M |
| XLogP | 1.02 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|