C16H31NO4S — CID 139201811
[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonate;dipropylazanium (PubChem CID 139201811) has the molecular formula C16H31NO4S and a molecular weight of 333.49 g/mol. Its IUPAC name is [(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonate;dipropylazanium.
| Compound Name | [(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonate;dipropylazanium |
|---|---|
| PubChem CID | 139201811 |
| Molecular Formula | C16H31NO4S |
| Molecular Weight | 333.49 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | [(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonate;dipropylazanium |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)[O-])C(=O)C2.CCC[NH2+]CCC |
| InChI | InChI=1S/C10H16O4S.C6H15N/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14;1-3-5-7-6-4-2/h7H,3-6H2,1-2H3,(H,12,13,14);7H,3-6H2,1-2H3/t7-,10-;/m1./s1 |
| InChIKey | QTGINNGSFMKJGP-YZUKSGEXSA-N |
| XLogP | 1.30 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.49 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|