C21H38O5S2 — CID 18548092
(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate;2-oxopentyl-di(propan-2-yl)sulfanium (PubChem CID 18548092) has the molecular formula C21H38O5S2 and a molecular weight of 434.66 g/mol. Its IUPAC name is (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate;2-oxopentyl-di(propan-2-yl)sulfanium.
| Compound Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate;2-oxopentyl-di(propan-2-yl)sulfanium |
|---|---|
| PubChem CID | 18548092 |
| Molecular Formula | C21H38O5S2 |
| Molecular Weight | 434.66 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate;2-oxopentyl-di(propan-2-yl)sulfanium |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)[O-])C(=O)C2.CCCC(=O)C[S+](C(C)C)C(C)C |
| InChI | InChI=1S/C11H23OS.C10H16O4S/c1-6-7-11(12)8-13(9(2)3)10(4)5;1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h9-10H,6-8H2,1-5H3;7H,3-6H2,1-2H3,(H,12,13,14)/q+1;/p-1 |
| InChIKey | UGGHWBMWEZEOLD-UHFFFAOYSA-M |
| XLogP | 3.72 |
| TPSA | 91.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.66 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|