C22H38O6S2 — CID 18547797
(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate;1-(1,4-oxathian-4-ium-4-yl)octan-2-one (PubChem CID 18547797) has the molecular formula C22H38O6S2 and a molecular weight of 462.67 g/mol. Its IUPAC name is (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate;1-(1,4-oxathian-4-ium-4-yl)octan-2-one.
| Compound Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate;1-(1,4-oxathian-4-ium-4-yl)octan-2-one |
|---|---|
| PubChem CID | 18547797 |
| Molecular Formula | C22H38O6S2 |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate;1-(1,4-oxathian-4-ium-4-yl)octan-2-one |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)[O-])C(=O)C2.CCCCCCC(=O)C[S+]1CCOCC1 |
| InChI | InChI=1S/C12H23O2S.C10H16O4S/c1-2-3-4-5-6-12(13)11-15-9-7-14-8-10-15;1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h2-11H2,1H3;7H,3-6H2,1-2H3,(H,12,13,14)/q+1;/p-1 |
| InChIKey | LTQLAQKAIWFFHI-UHFFFAOYSA-M |
| XLogP | 3.10 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|