C46H66O4S2 — CID 157333387
(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate;diphenyl-(2,4,6-trihexylphenyl)sulfanium (PubChem CID 157333387) has the molecular formula C46H66O4S2 and a molecular weight of 747.16 g/mol. Its IUPAC name is (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate;diphenyl-(2,4,6-trihexylphenyl)sulfanium.
| Compound Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate;diphenyl-(2,4,6-trihexylphenyl)sulfanium |
|---|---|
| PubChem CID | 157333387 |
| Molecular Formula | C46H66O4S2 |
| Molecular Weight | 747.16 g/mol |
| Exact Mass | 746.44 |
| IUPAC Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate;diphenyl-(2,4,6-trihexylphenyl)sulfanium |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)[O-])C(=O)C2.CCCCCCc1cc(CCCCCC)c([S+](c2ccccc2)c2ccccc2)c(CCCCCC)c1 |
| InChI | InChI=1S/C36H51S.C10H16O4S/c1-4-7-10-15-22-31-29-32(23-16-11-8-5-2)36(33(30-31)24-17-12-9-6-3)37(34-25-18-13-19-26-34)35-27-20-14-21-28-35;1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h13-14,18-21,25-30H,4-12,15-17,22-24H2,1-3H3;7H,3-6H2,1-2H3,(H,12,13,14)/q+1;/p-1 |
| InChIKey | BFNZVJZKSIPLOI-UHFFFAOYSA-M |
| XLogP | 12.08 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.16 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|