C19H37N3O5S — CID 163685318
[(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;pentanamide;piperazine (PubChem CID 163685318) has the molecular formula C19H37N3O5S and a molecular weight of 419.59 g/mol. Its IUPAC name is [(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;pentanamide;piperazine.
| Compound Name | [(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;pentanamide;piperazine |
|---|---|
| PubChem CID | 163685318 |
| Molecular Formula | C19H37N3O5S |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | [(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;pentanamide;piperazine |
| SMILES | C1CNCCN1.CC1(C)C2CC[C@@]1(CS(=O)(=O)O)C(=O)C2.CCCCC(N)=O |
| InChI | InChI=1S/C10H16O4S.C5H11NO.C4H10N2/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14;1-2-3-4-5(6)7;1-2-6-4-3-5-1/h7H,3-6H2,1-2H3,(H,12,13,14);2-4H2,1H3,(H2,6,7);5-6H,1-4H2/t7?,10-;;/m1../s1 |
| InChIKey | JOJJBASMICQLLU-TXQLSXHESA-N |
| XLogP | 1.11 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|