C17H31NO5S — CID 87205898
(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;2-[(2S)-piperidin-2-yl]ethanol (PubChem CID 87205898) has the molecular formula C17H31NO5S and a molecular weight of 361.50 g/mol. Its IUPAC name is (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;2-[(2S)-piperidin-2-yl]ethanol.
| Compound Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;2-[(2S)-piperidin-2-yl]ethanol |
|---|---|
| PubChem CID | 87205898 |
| Molecular Formula | C17H31NO5S |
| Molecular Weight | 361.50 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;2-[(2S)-piperidin-2-yl]ethanol |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2.OCC[C@@H]1CCCCN1 |
| InChI | InChI=1S/C10H16O4S.C7H15NO/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14;9-6-4-7-3-1-2-5-8-7/h7H,3-6H2,1-2H3,(H,12,13,14);7-9H,1-6H2/t;7-/m.0/s1 |
| InChIKey | CWDUSEOMJALTJL-ZLTKDMPESA-N |
| XLogP | 1.78 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.50 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|