C17H22O6S — CID 161349813
benzoic acid;(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid (PubChem CID 161349813) has the molecular formula C17H22O6S and a molecular weight of 354.42 g/mol. Its IUPAC name is benzoic acid;(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid.
| Compound Name | benzoic acid;(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid |
|---|---|
| PubChem CID | 161349813 |
| Molecular Formula | C17H22O6S |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | benzoic acid;(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C10H16O4S.C7H6O2/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14;8-7(9)6-4-2-1-3-5-6/h7H,3-6H2,1-2H3,(H,12,13,14);1-5H,(H,8,9) |
| InChIKey | VNTZUQWNUGGZGH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|