C27H35NO4S — CID 146423125
(2S)-1-benzhydryl-2-methylazetidine;[(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid (PubChem CID 146423125) has the molecular formula C27H35NO4S and a molecular weight of 469.65 g/mol. Its IUPAC name is (2S)-1-benzhydryl-2-methylazetidine;[(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid.
| Compound Name | (2S)-1-benzhydryl-2-methylazetidine;[(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
|---|---|
| PubChem CID | 146423125 |
| Molecular Formula | C27H35NO4S |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | (2S)-1-benzhydryl-2-methylazetidine;[(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
| SMILES | CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)O)C(=O)C2.C[C@H]1CCN1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19N.C10H16O4S/c1-14-12-13-18(14)17(15-8-4-2-5-9-15)16-10-6-3-7-11-16;1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h2-11,14,17H,12-13H2,1H3;7H,3-6H2,1-2H3,(H,12,13,14)/t14-;7-,10-/m00/s1 |
| InChIKey | WTJUXIVJCJSBMN-IMWBMVJGSA-N |
| XLogP | 5.14 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|