C17H31NO4S — CID 2422571
N-(3-butoxypropyl)-1-[(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonamide (PubChem CID 2422571) has the molecular formula C17H31NO4S and a molecular weight of 345.51 g/mol. Its IUPAC name is N-(3-butoxypropyl)-1-[(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonamide.
| Compound Name | N-(3-butoxypropyl)-1-[(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonamide |
|---|---|
| PubChem CID | 2422571 |
| Molecular Formula | C17H31NO4S |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | N-(3-butoxypropyl)-1-[(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonamide |
| SMILES | CCCCOCCCNS(=O)(=O)C[C@@]12CC[C@@H](CC1=O)C2(C)C |
| InChI | InChI=1S/C17H31NO4S/c1-4-5-10-22-11-6-9-18-23(20,21)13-17-8-7-14(12-15(17)19)16(17,2)3/h14,18H,4-13H2,1-3H3/t14-,17-/m0/s1 |
| InChIKey | GAXUCPQQCPHZRA-YOEHRIQHSA-N |
| XLogP | 2.51 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|