C21H39N2O3S+ — CID 23314693
1-[(1R,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]-N-[2-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)ethyl]methanesulfonamide (PubChem CID 23314693) has the molecular formula C21H39N2O3S+ and a molecular weight of 399.62 g/mol. Its IUPAC name is 1-[(1R,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]-N-[2-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)ethyl]methanesulfonamide.
| Compound Name | 1-[(1R,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]-N-[2-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 23314693 |
| Molecular Formula | C21H39N2O3S+ |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.27 |
| IUPAC Name | 1-[(1R,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]-N-[2-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)ethyl]methanesulfonamide |
| SMILES | CC1(C)CC(CCNS(=O)(=O)C[C@@]23CC[C@H](CC2=O)C3(C)C)CC(C)(C)[NH2+]1 |
| InChI | InChI=1S/C21H38N2O3S/c1-18(2)12-15(13-19(3,4)23-18)8-10-22-27(25,26)14-21-9-7-16(11-17(21)24)20(21,5)6/h15-16,22-23H,7-14H2,1-6H3/p+1/t16-,21+/m1/s1 |
| InChIKey | BBFYWXLQHFLLFN-IERDGZPVSA-O |
| XLogP | 2.22 |
| TPSA | 79.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |