C15H29ClN2O3S — CID 135389995
3-[[(1S,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methylsulfonylamino]propyl-dimethylazanium chloride (PubChem CID 135389995) has the molecular formula C15H29ClN2O3S and a molecular weight of 352.93 g/mol. Its IUPAC name is 3-[[(1S,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methylsulfonylamino]propyl-dimethylazanium chloride.
| Compound Name | 3-[[(1S,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methylsulfonylamino]propyl-dimethylazanium chloride |
|---|---|
| PubChem CID | 135389995 |
| Molecular Formula | C15H29ClN2O3S |
| Molecular Weight | 352.93 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 3-[[(1S,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methylsulfonylamino]propyl-dimethylazanium chloride |
| SMILES | C[NH+](C)CCCNS(=O)(=O)C[C@]12CC[C@@H](CC1=O)C2(C)C.[Cl-] |
| InChI | InChI=1S/C15H28N2O3S.ClH/c1-14(2)12-6-7-15(14,13(18)10-12)11-21(19,20)16-8-5-9-17(3)4;/h12,16H,5-11H2,1-4H3;1H/t12-,15+;/m0./s1 |
| InChIKey | MEYDAGJNMOMFPC-SBKWZQTDSA-N |
| XLogP | -3.16 |
| TPSA | 67.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.93 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|