C10H17O5P — CID 174251091
(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methyl dihydrogen phosphate (PubChem CID 174251091) has the molecular formula C10H17O5P and a molecular weight of 248.21 g/mol. Its IUPAC name is (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methyl dihydrogen phosphate.
| Compound Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 174251091 |
| Molecular Formula | C10H17O5P |
| Molecular Weight | 248.21 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methyl dihydrogen phosphate |
| SMILES | CC1(C)C2CCC1(COP(=O)(O)O)C(=O)C2 |
| InChI | InChI=1S/C10H17O5P/c1-9(2)7-3-4-10(9,8(11)5-7)6-15-16(12,13)14/h7H,3-6H2,1-2H3,(H2,12,13,14) |
| InChIKey | SNBSQXGQJMQYIQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.21 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|