C22H24O4S — CID 174507031
phenyl (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-phenylmethanesulfonate (PubChem CID 174507031) has the molecular formula C22H24O4S and a molecular weight of 384.50 g/mol. Its IUPAC name is phenyl (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-phenylmethanesulfonate.
| Compound Name | phenyl (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-phenylmethanesulfonate |
|---|---|
| PubChem CID | 174507031 |
| Molecular Formula | C22H24O4S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | phenyl (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-phenylmethanesulfonate |
| SMILES | CC1(C)C2CCC1(C(c1ccccc1)S(=O)(=O)Oc1ccccc1)C(=O)C2 |
| InChI | InChI=1S/C22H24O4S/c1-21(2)17-13-14-22(21,19(23)15-17)20(16-9-5-3-6-10-16)27(24,25)26-18-11-7-4-8-12-18/h3-12,17,20H,13-15H2,1-2H3 |
| InChIKey | POLWDHLDJZNSAB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|