C10H14BrClO3S — CID 91306431
bromo-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonyl chloride (PubChem CID 91306431) has the molecular formula C10H14BrClO3S and a molecular weight of 329.64 g/mol. Its IUPAC name is bromo-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonyl chloride.
| Compound Name | bromo-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonyl chloride |
|---|---|
| PubChem CID | 91306431 |
| Molecular Formula | C10H14BrClO3S |
| Molecular Weight | 329.64 g/mol |
| Exact Mass | 327.95 |
| IUPAC Name | bromo-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonyl chloride |
| SMILES | CC1(C)C2CCC1(C(Br)S(=O)(=O)Cl)C(=O)C2 |
| InChI | InChI=1S/C10H14BrClO3S/c1-9(2)6-3-4-10(9,7(13)5-6)8(11)16(12,14)15/h6,8H,3-5H2,1-2H3 |
| InChIKey | BGWIJHSRGXSACC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.64 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|