C11H16Br2O — CID 12014132
(1S,4R)-1-[(1S)-1,2-dibromoethyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 12014132) has the molecular formula C11H16Br2O and a molecular weight of 324.06 g/mol. Its IUPAC name is (1S,4R)-1-[(1S)-1,2-dibromoethyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (1S,4R)-1-[(1S)-1,2-dibromoethyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 12014132 |
| Molecular Formula | C11H16Br2O |
| Molecular Weight | 324.06 g/mol |
| Exact Mass | 321.96 |
| IUPAC Name | (1S,4R)-1-[(1S)-1,2-dibromoethyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)[C@@H]2CC[C@@]1([C@H](Br)CBr)C(=O)C2 |
| InChI | InChI=1S/C11H16Br2O/c1-10(2)7-3-4-11(10,8(13)6-12)9(14)5-7/h7-8H,3-6H2,1-2H3/t7-,8-,11-/m1/s1 |
| InChIKey | IGTPOEJBBYKKSC-SOCHQFKDSA-N |
| XLogP | 3.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.06 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|