C33H41NO8S — CID 53239219
(1R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-sulfonic acid;2,3,6,7-tetramethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine (PubChem CID 53239219) has the molecular formula C33H41NO8S and a molecular weight of 611.76 g/mol. Its IUPAC name is (1R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-sulfonic acid;2,3,6,7-tetramethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine.
| Compound Name | (1R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-sulfonic acid;2,3,6,7-tetramethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine |
|---|---|
| PubChem CID | 53239219 |
| Molecular Formula | C33H41NO8S |
| Molecular Weight | 611.76 g/mol |
| Exact Mass | 611.26 |
| IUPAC Name | (1R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-sulfonic acid;2,3,6,7-tetramethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine |
| SMILES | CC1(C)C2CC[C@]1(S(=O)(=O)O)C(=O)C2.COc1cc2c3c(c4cc(OC)c(OC)cc4c2cc1OC)CN1CCCC1C3 |
| InChI | InChI=1S/C24H27NO4.C9H14O4S/c1-26-21-9-16-15-8-14-6-5-7-25(14)13-20(15)19-12-24(29-4)23(28-3)11-18(19)17(16)10-22(21)27-2;1-8(2)6-3-4-9(8,7(10)5-6)14(11,12)13/h9-12,14H,5-8,13H2,1-4H3;6H,3-5H2,1-2H3,(H,11,12,13)/t;6?,9-/m.0/s1 |
| InChIKey | XYDRAHWJEIZDGL-NWRCXQRFSA-N |
| XLogP | 5.57 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.76 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|