C28H43NO4S — CID 42612552
(2R)-2-[[(1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 42612552) has the molecular formula C28H43NO4S and a molecular weight of 489.72 g/mol. Its IUPAC name is (2R)-2-[[(1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[(1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 42612552 |
| Molecular Formula | C28H43NO4S |
| Molecular Weight | 489.72 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | (2R)-2-[[(1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSC[C@H](NC(=O)[C@]12CC[C@H](CC1=O)C2(C)C)C(=O)O |
| InChI | InChI=1S/C28H43NO4S/c1-19(2)9-7-10-20(3)11-8-12-21(4)14-16-34-18-23(25(31)32)29-26(33)28-15-13-22(17-24(28)30)27(28,5)6/h9,11,14,22-23H,7-8,10,12-13,15-18H2,1-6H3,(H,29,33)(H,31,32)/b20-11+,21-14+/t22-,23+,28+/m1/s1 |
| InChIKey | AIJCUWZZDKNNMA-HVCSLENFSA-N |
| XLogP | 6.10 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.72 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|