C15H16O3 — CID 129362698
4-hydroxy-6-[(2S)-1-phenylbutan-2-yl]pyran-2-one (PubChem CID 129362698) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is 4-hydroxy-6-[(2S)-1-phenylbutan-2-yl]pyran-2-one.
| Compound Name | 4-hydroxy-6-[(2S)-1-phenylbutan-2-yl]pyran-2-one |
|---|---|
| PubChem CID | 129362698 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 4-hydroxy-6-[(2S)-1-phenylbutan-2-yl]pyran-2-one |
| SMILES | CC[C@@H](Cc1ccccc1)c1cc(O)cc(=O)o1 |
| InChI | InChI=1S/C15H16O3/c1-2-12(8-11-6-4-3-5-7-11)14-9-13(16)10-15(17)18-14/h3-7,9-10,12,16H,2,8H2,1H3/t12-/m0/s1 |
| InChIKey | KQBQQCNEFJMCES-LBPRGKRZSA-N |
| XLogP | 3.08 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |