C28H28O3 — CID 54720642
4-hydroxy-6-(1-naphthalen-2-ylbutan-2-yl)-3-(1-phenylpropyl)pyran-2-one (PubChem CID 54720642) has the molecular formula C28H28O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is 4-hydroxy-6-(1-naphthalen-2-ylbutan-2-yl)-3-(1-phenylpropyl)pyran-2-one.
| Compound Name | 4-hydroxy-6-(1-naphthalen-2-ylbutan-2-yl)-3-(1-phenylpropyl)pyran-2-one |
|---|---|
| PubChem CID | 54720642 |
| Molecular Formula | C28H28O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 4-hydroxy-6-(1-naphthalen-2-ylbutan-2-yl)-3-(1-phenylpropyl)pyran-2-one |
| SMILES | CCC(Cc1ccc2ccccc2c1)c1cc(O)c(C(CC)c2ccccc2)c(=O)o1 |
| InChI | InChI=1S/C28H28O3/c1-3-20(16-19-14-15-21-10-8-9-13-23(21)17-19)26-18-25(29)27(28(30)31-26)24(4-2)22-11-6-5-7-12-22/h5-15,17-18,20,24,29H,3-4,16H2,1-2H3 |
| InChIKey | FMQNHFMTPQWKIH-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |