C21H24O4S — CID 54734856
6-[1-(furan-3-yl)butan-2-yl]-4-hydroxy-3-[1-(5-methylthiophen-2-yl)propyl]pyran-2-one (PubChem CID 54734856) has the molecular formula C21H24O4S and a molecular weight of 372.49 g/mol. Its IUPAC name is 6-[1-(furan-3-yl)butan-2-yl]-4-hydroxy-3-[1-(5-methylthiophen-2-yl)propyl]pyran-2-one.
| Compound Name | 6-[1-(furan-3-yl)butan-2-yl]-4-hydroxy-3-[1-(5-methylthiophen-2-yl)propyl]pyran-2-one |
|---|---|
| PubChem CID | 54734856 |
| Molecular Formula | C21H24O4S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 6-[1-(furan-3-yl)butan-2-yl]-4-hydroxy-3-[1-(5-methylthiophen-2-yl)propyl]pyran-2-one |
| SMILES | CCC(Cc1ccoc1)c1cc(O)c(C(CC)c2ccc(C)s2)c(=O)o1 |
| InChI | InChI=1S/C21H24O4S/c1-4-15(10-14-8-9-24-12-14)18-11-17(22)20(21(23)25-18)16(5-2)19-7-6-13(3)26-19/h6-9,11-12,15-16,22H,4-5,10H2,1-3H3 |
| InChIKey | YMEOMNYXFMIRNH-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |