C22H30O4S — CID 54729588
4-hydroxy-3-[1-(5-methylthiophen-2-yl)propyl]-6-[1-(oxan-4-yl)butan-2-yl]pyran-2-one (PubChem CID 54729588) has the molecular formula C22H30O4S and a molecular weight of 390.55 g/mol. Its IUPAC name is 4-hydroxy-3-[1-(5-methylthiophen-2-yl)propyl]-6-[1-(oxan-4-yl)butan-2-yl]pyran-2-one.
| Compound Name | 4-hydroxy-3-[1-(5-methylthiophen-2-yl)propyl]-6-[1-(oxan-4-yl)butan-2-yl]pyran-2-one |
|---|---|
| PubChem CID | 54729588 |
| Molecular Formula | C22H30O4S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 4-hydroxy-3-[1-(5-methylthiophen-2-yl)propyl]-6-[1-(oxan-4-yl)butan-2-yl]pyran-2-one |
| SMILES | CCC(CC1CCOCC1)c1cc(O)c(C(CC)c2ccc(C)s2)c(=O)o1 |
| InChI | InChI=1S/C22H30O4S/c1-4-16(12-15-8-10-25-11-9-15)19-13-18(23)21(22(24)26-19)17(5-2)20-7-6-14(3)27-20/h6-7,13,15-17,23H,4-5,8-12H2,1-3H3 |
| InChIKey | DTYLIOQDDGEXTJ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |