C25H26O3 — CID 54720680
4-hydroxy-6-(1-phenylbutan-2-yl)-3-(1-phenylcyclobutyl)pyran-2-one (PubChem CID 54720680) has the molecular formula C25H26O3 and a molecular weight of 374.48 g/mol. Its IUPAC name is 4-hydroxy-6-(1-phenylbutan-2-yl)-3-(1-phenylcyclobutyl)pyran-2-one.
| Compound Name | 4-hydroxy-6-(1-phenylbutan-2-yl)-3-(1-phenylcyclobutyl)pyran-2-one |
|---|---|
| PubChem CID | 54720680 |
| Molecular Formula | C25H26O3 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 4-hydroxy-6-(1-phenylbutan-2-yl)-3-(1-phenylcyclobutyl)pyran-2-one |
| SMILES | CCC(Cc1ccccc1)c1cc(O)c(C2(c3ccccc3)CCC2)c(=O)o1 |
| InChI | InChI=1S/C25H26O3/c1-2-19(16-18-10-5-3-6-11-18)22-17-21(26)23(24(27)28-22)25(14-9-15-25)20-12-7-4-8-13-20/h3-8,10-13,17,19,26H,2,9,14-16H2,1H3 |
| InChIKey | NXINUFZPBCOGBN-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |