C31H32N2O5S — CID 67811487
3-amino-N-[2-[[4-hydroxy-2-oxo-6-(1-phenylbutan-2-yl)pyran-3-yl]-phenylmethyl]cyclopropyl]benzenesulfonamide (PubChem CID 67811487) has the molecular formula C31H32N2O5S and a molecular weight of 544.67 g/mol. Its IUPAC name is 3-amino-N-[2-[[4-hydroxy-2-oxo-6-(1-phenylbutan-2-yl)pyran-3-yl]-phenylmethyl]cyclopropyl]benzenesulfonamide.
| Compound Name | 3-amino-N-[2-[[4-hydroxy-2-oxo-6-(1-phenylbutan-2-yl)pyran-3-yl]-phenylmethyl]cyclopropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 67811487 |
| Molecular Formula | C31H32N2O5S |
| Molecular Weight | 544.67 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | 3-amino-N-[2-[[4-hydroxy-2-oxo-6-(1-phenylbutan-2-yl)pyran-3-yl]-phenylmethyl]cyclopropyl]benzenesulfonamide |
| SMILES | CCC(Cc1ccccc1)c1cc(O)c(C(c2ccccc2)C2CC2NS(=O)(=O)c2cccc(N)c2)c(=O)o1 |
| InChI | InChI=1S/C31H32N2O5S/c1-2-21(16-20-10-5-3-6-11-20)28-19-27(34)30(31(35)38-28)29(22-12-7-4-8-13-22)25-18-26(25)33-39(36,37)24-15-9-14-23(32)17-24/h3-15,17,19,21,25-26,29,33-34H,2,16,18,32H2,1H3 |
| InChIKey | LNBGGLIZPRUYBU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.67 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|