C17H21NO3 — CID 101257150
(5S)-5-[(1R)-1-hydroxy-2-phenylethyl]-5-methyl-4-pyrrolidin-1-ylfuran-2-one (PubChem CID 101257150) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is (5S)-5-[(1R)-1-hydroxy-2-phenylethyl]-5-methyl-4-pyrrolidin-1-ylfuran-2-one.
| Compound Name | (5S)-5-[(1R)-1-hydroxy-2-phenylethyl]-5-methyl-4-pyrrolidin-1-ylfuran-2-one |
|---|---|
| PubChem CID | 101257150 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (5S)-5-[(1R)-1-hydroxy-2-phenylethyl]-5-methyl-4-pyrrolidin-1-ylfuran-2-one |
| SMILES | C[C@]1([C@H](O)Cc2ccccc2)OC(=O)C=C1N1CCCC1 |
| InChI | InChI=1S/C17H21NO3/c1-17(15(19)11-13-7-3-2-4-8-13)14(12-16(20)21-17)18-9-5-6-10-18/h2-4,7-8,12,15,19H,5-6,9-11H2,1H3/t15-,17+/m1/s1 |
| InChIKey | HVVMYTOTDSRJQT-WBVHZDCISA-N |
| XLogP | 1.89 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |