C14H19NO3 — CID 151786501
(1-methoxy-2-phenylethyl) pyrrolidine-1-carboxylate (PubChem CID 151786501) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is (1-methoxy-2-phenylethyl) pyrrolidine-1-carboxylate.
| Compound Name | (1-methoxy-2-phenylethyl) pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 151786501 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | (1-methoxy-2-phenylethyl) pyrrolidine-1-carboxylate |
| SMILES | COC(Cc1ccccc1)OC(=O)N1CCCC1 |
| InChI | InChI=1S/C14H19NO3/c1-17-13(11-12-7-3-2-4-8-12)18-14(16)15-9-5-6-10-15/h2-4,7-8,13H,5-6,9-11H2,1H3 |
| InChIKey | RVSGSTBQJWCNBS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|