About (2-phenoxy-1-phenylmethoxyethyl) azepane-1-carboxylate
(2-phenoxy-1-phenylmethoxyethyl) azepane-1-carboxylate (PubChem CID 57003333) has the molecular formula C22H27NO4
and a molecular weight of 369.46 g/mol. Its IUPAC name is (2-phenoxy-1-phenylmethoxyethyl) azepane-1-carboxylate.
Molecular Properties
| Compound Name | (2-phenoxy-1-phenylmethoxyethyl) azepane-1-carboxylate |
| PubChem CID | 57003333 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (2-phenoxy-1-phenylmethoxyethyl) azepane-1-carboxylate |
| SMILES | O=C(OC(COc1ccccc1)OCc1ccccc1)N1CCCCCC1 |
| InChI | InChI=1S/C22H27NO4/c24-22(23-15-9-1-2-10-16-23)27-21(18-25-20-13-7-4-8-14-20)26-17-19-11-5-3-6-12-19/h3-8,11-14,21H,1-2,9-10,15-18H2 |
| InChIKey | CZIMAFRZZKUQTC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2-phenoxy-1-phenylmethoxyethyl) azepane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenoxy-1-phenylmethoxyethyl) azepane-1-carboxylate?
The IUPAC name of (2-phenoxy-1-phenylmethoxyethyl) azepane-1-carboxylate (CID 57003333) is (2-phenoxy-1-phenylmethoxyethyl) azepane-1-carboxylate.
What is the SMILES notation for (2-phenoxy-1-phenylmethoxyethyl) azepane-1-carboxylate?
The canonical SMILES for (2-phenoxy-1-phenylmethoxyethyl) azepane-1-carboxylate is O=C(OC(COc1ccccc1)OCc1ccccc1)N1CCCCCC1.
What is the InChIKey of (2-phenoxy-1-phenylmethoxyethyl) azepane-1-carboxylate?
The InChIKey is CZIMAFRZZKUQTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO4/c24-22(23-15-9-1-2-10-16-23)27-21(18-25-20-13-7-4-8-14-20)26-17-19-11-5-3-6-12-19/h3-8,11-14,21H,1-2,9-10,15-18H2.
What are the key properties of (2-phenoxy-1-phenylmethoxyethyl) azepane-1-carboxylate?
(2-phenoxy-1-phenylmethoxyethyl) azepane-1-carboxylate has a molecular weight of 369.46 g/mol, XLogP of 4.62, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenoxy-1-phenylmethoxyethyl) azepane-1-carboxylate is sourced from PubChem (CID 57003333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).