C32H34O6 — CID 3011292
(2R,3R,4S,5R)-1,6-diphenoxy-2,5-bis(phenylmethoxy)hexane-3,4-diol (PubChem CID 3011292) has the molecular formula C32H34O6 and a molecular weight of 514.62 g/mol. Its IUPAC name is (2R,3R,4S,5R)-1,6-diphenoxy-2,5-bis(phenylmethoxy)hexane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-1,6-diphenoxy-2,5-bis(phenylmethoxy)hexane-3,4-diol |
|---|---|
| PubChem CID | 3011292 |
| Molecular Formula | C32H34O6 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | (2R,3R,4S,5R)-1,6-diphenoxy-2,5-bis(phenylmethoxy)hexane-3,4-diol |
| SMILES | O[C@H]([C@H](O)[C@@H](COc1ccccc1)OCc1ccccc1)[C@@H](COc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C32H34O6/c33-31(29(23-35-27-17-9-3-10-18-27)37-21-25-13-5-1-6-14-25)32(34)30(24-36-28-19-11-4-12-20-28)38-22-26-15-7-2-8-16-26/h1-20,29-34H,21-24H2/t29-,30-,31-,32+/m1/s1 |
| InChIKey | JOUWJRQPBJVSNU-ANLCFORVSA-N |
| XLogP | 5.04 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |