C10H14O5 — CID 173269975
2-(phenoxymethyl)propane-1,1,3,3-tetrol (PubChem CID 173269975) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is 2-(phenoxymethyl)propane-1,1,3,3-tetrol.
| Compound Name | 2-(phenoxymethyl)propane-1,1,3,3-tetrol |
|---|---|
| PubChem CID | 173269975 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-(phenoxymethyl)propane-1,1,3,3-tetrol |
| SMILES | OC(O)C(COc1ccccc1)C(O)O |
| InChI | InChI=1S/C10H14O5/c11-9(12)8(10(13)14)6-15-7-4-2-1-3-5-7/h1-5,8-14H,6H2 |
| InChIKey | DLZZNELWGFNQOB-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|