About ethane;1-phenoxypropan-2-ol;propane
ethane;1-phenoxypropan-2-ol;propane (PubChem CID 90979198) has the molecular formula C16H32O2
and a molecular weight of 256.43 g/mol. Its IUPAC name is ethane;1-phenoxypropan-2-ol;propane.
Molecular Properties
| Compound Name | ethane;1-phenoxypropan-2-ol;propane |
| PubChem CID | 90979198 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | ethane;1-phenoxypropan-2-ol;propane |
| SMILES | CC.CC.CC(O)COc1ccccc1.CCC |
| InChI | InChI=1S/C9H12O2.C3H8.2C2H6/c1-8(10)7-11-9-5-3-2-4-6-9;1-3-2;2*1-2/h2-6,8,10H,7H2,1H3;3H2,1-2H3;2*1-2H3 |
| InChIKey | MSKKLGPZVPZJFK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-phenoxypropan-2-ol;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-phenoxypropan-2-ol;propane?
The IUPAC name of ethane;1-phenoxypropan-2-ol;propane (CID 90979198) is ethane;1-phenoxypropan-2-ol;propane.
What is the SMILES notation for ethane;1-phenoxypropan-2-ol;propane?
The canonical SMILES for ethane;1-phenoxypropan-2-ol;propane is CC.CC.CC(O)COc1ccccc1.CCC.
What is the InChIKey of ethane;1-phenoxypropan-2-ol;propane?
The InChIKey is MSKKLGPZVPZJFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2.C3H8.2C2H6/c1-8(10)7-11-9-5-3-2-4-6-9;1-3-2;2*1-2/h2-6,8,10H,7H2,1H3;3H2,1-2H3;2*1-2H3.
What are the key properties of ethane;1-phenoxypropan-2-ol;propane?
ethane;1-phenoxypropan-2-ol;propane has a molecular weight of 256.43 g/mol, XLogP of 4.91, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-phenoxypropan-2-ol;propane is sourced from PubChem (CID 90979198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).