About benzoic acid;1-phenoxypropan-2-ol
benzoic acid;1-phenoxypropan-2-ol (PubChem CID 70185912) has the molecular formula C16H18O4
and a molecular weight of 274.32 g/mol. Its IUPAC name is benzoic acid;1-phenoxypropan-2-ol.
Molecular Properties
| Compound Name | benzoic acid;1-phenoxypropan-2-ol |
| PubChem CID | 70185912 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | benzoic acid;1-phenoxypropan-2-ol |
| SMILES | CC(O)COc1ccccc1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C9H12O2.C7H6O2/c1-8(10)7-11-9-5-3-2-4-6-9;8-7(9)6-4-2-1-3-5-6/h2-6,8,10H,7H2,1H3;1-5H,(H,8,9) |
| InChIKey | AKEYNRNPUZXASQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzoic acid;1-phenoxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;1-phenoxypropan-2-ol?
The IUPAC name of benzoic acid;1-phenoxypropan-2-ol (CID 70185912) is benzoic acid;1-phenoxypropan-2-ol.
What is the SMILES notation for benzoic acid;1-phenoxypropan-2-ol?
The canonical SMILES for benzoic acid;1-phenoxypropan-2-ol is CC(O)COc1ccccc1.O=C(O)c1ccccc1.
What is the InChIKey of benzoic acid;1-phenoxypropan-2-ol?
The InChIKey is AKEYNRNPUZXASQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2.C7H6O2/c1-8(10)7-11-9-5-3-2-4-6-9;8-7(9)6-4-2-1-3-5-6/h2-6,8,10H,7H2,1H3;1-5H,(H,8,9).
What are the key properties of benzoic acid;1-phenoxypropan-2-ol?
benzoic acid;1-phenoxypropan-2-ol has a molecular weight of 274.32 g/mol, XLogP of 2.83, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;1-phenoxypropan-2-ol is sourced from PubChem (CID 70185912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).