acetic acid;1-phenoxypropan-2-ol

C11H16O4 — CID 68567525

IUPACacetic acid;1-phenoxypropan-2-ol
SMILESCC(=O)O.CC(O)COc1ccccc1
InChIInChI=1S/C9H12O2.C2H4O2/c1-8(10)7-11-9-5-3-2-4-6-9;1-2(3)4/h2-6,8,10H,7H2,1H3;1H3,(H,3,4)
InChIKeyIJMMLESAAHRIPW-UHFFFAOYSA-N
MW212.25 g/mol
LogP1.54
Rot. Bonds3

About acetic acid;1-phenoxypropan-2-ol

acetic acid;1-phenoxypropan-2-ol (PubChem CID 68567525) has the molecular formula C11H16O4 and a molecular weight of 212.25 g/mol. Its IUPAC name is acetic acid;1-phenoxypropan-2-ol.

Molecular Properties

Compound Nameacetic acid;1-phenoxypropan-2-ol
PubChem CID68567525
Molecular FormulaC11H16O4
Molecular Weight212.25 g/mol
Exact Mass212.10
IUPAC Nameacetic acid;1-phenoxypropan-2-ol
SMILESCC(=O)O.CC(O)COc1ccccc1
InChIInChI=1S/C9H12O2.C2H4O2/c1-8(10)7-11-9-5-3-2-4-6-9;1-2(3)4/h2-6,8,10H,7H2,1H3;1H3,(H,3,4)
InChIKeyIJMMLESAAHRIPW-UHFFFAOYSA-N
XLogP1.54
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.25
LogP ≤ 51.54
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze acetic acid;1-phenoxypropan-2-ol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;1-phenoxypropan-2-ol?
The IUPAC name of acetic acid;1-phenoxypropan-2-ol (CID 68567525) is acetic acid;1-phenoxypropan-2-ol.
What is the SMILES notation for acetic acid;1-phenoxypropan-2-ol?
The canonical SMILES for acetic acid;1-phenoxypropan-2-ol is CC(=O)O.CC(O)COc1ccccc1.
What is the InChIKey of acetic acid;1-phenoxypropan-2-ol?
The InChIKey is IJMMLESAAHRIPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2.C2H4O2/c1-8(10)7-11-9-5-3-2-4-6-9;1-2(3)4/h2-6,8,10H,7H2,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;1-phenoxypropan-2-ol?
acetic acid;1-phenoxypropan-2-ol has a molecular weight of 212.25 g/mol, XLogP of 1.54, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1-phenoxypropan-2-ol is sourced from PubChem (CID 68567525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).