About 1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(1-phenoxypropan-2-ol)
1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(1-phenoxypropan-2-ol) (PubChem CID 91213625) has the molecular formula C35H46O4
and a molecular weight of 530.75 g/mol. Its IUPAC name is 1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(1-phenoxypropan-2-ol).
Molecular Properties
| Compound Name | 1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(1-phenoxypropan-2-ol) |
| PubChem CID | 91213625 |
| Molecular Formula | C35H46O4 |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 530.34 |
| IUPAC Name | 1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(1-phenoxypropan-2-ol) |
| SMILES | C.CC(O)COc1ccccc1.CC(O)COc1ccccc1.CCc1ccc(-c2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C16H18.2C9H12O2.CH4/c1-3-13-5-9-15(10-6-13)16-11-7-14(4-2)8-12-16;2*1-8(10)7-11-9-5-3-2-4-6-9;/h5-12H,3-4H2,1-2H3;2*2-6,8,10H,7H2,1H3;1H4 |
| InChIKey | WZBGSQUDFUSLDF-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(1-phenoxypropan-2-ol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(1-phenoxypropan-2-ol)?
The IUPAC name of 1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(1-phenoxypropan-2-ol) (CID 91213625) is 1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(1-phenoxypropan-2-ol).
What is the SMILES notation for 1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(1-phenoxypropan-2-ol)?
The canonical SMILES for 1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(1-phenoxypropan-2-ol) is C.CC(O)COc1ccccc1.CC(O)COc1ccccc1.CCc1ccc(-c2ccc(CC)cc2)cc1.
What is the InChIKey of 1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(1-phenoxypropan-2-ol)?
The InChIKey is WZBGSQUDFUSLDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18.2C9H12O2.CH4/c1-3-13-5-9-15(10-6-13)16-11-7-14(4-2)8-12-16;2*1-8(10)7-11-9-5-3-2-4-6-9;/h5-12H,3-4H2,1-2H3;2*2-6,8,10H,7H2,1H3;1H4.
What are the key properties of 1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(1-phenoxypropan-2-ol)?
1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(1-phenoxypropan-2-ol) has a molecular weight of 530.75 g/mol, XLogP of 8.01, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(1-phenoxypropan-2-ol) is sourced from PubChem (CID 91213625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).