C12H17BrO2 — CID 131857038
(2S,3S)-3-bromo-1-(4-ethylphenoxy)butan-2-ol (PubChem CID 131857038) has the molecular formula C12H17BrO2 and a molecular weight of 273.17 g/mol. Its IUPAC name is (2S,3S)-3-bromo-1-(4-ethylphenoxy)butan-2-ol.
| Compound Name | (2S,3S)-3-bromo-1-(4-ethylphenoxy)butan-2-ol |
|---|---|
| PubChem CID | 131857038 |
| Molecular Formula | C12H17BrO2 |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | (2S,3S)-3-bromo-1-(4-ethylphenoxy)butan-2-ol |
| SMILES | CCc1ccc(OC[C@H](O)[C@H](C)Br)cc1 |
| InChI | InChI=1S/C12H17BrO2/c1-3-10-4-6-11(7-5-10)15-8-12(14)9(2)13/h4-7,9,12,14H,3,8H2,1-2H3/t9-,12-/m0/s1 |
| InChIKey | LFONOPFXEOUOQT-CABZTGNLSA-N |
| XLogP | 2.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|