C10H14O3 — CID 91592541
(2S,3R)-1-phenoxybutane-2,3-diol (PubChem CID 91592541) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is (2S,3R)-1-phenoxybutane-2,3-diol.
| Compound Name | (2S,3R)-1-phenoxybutane-2,3-diol |
|---|---|
| PubChem CID | 91592541 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (2S,3R)-1-phenoxybutane-2,3-diol |
| SMILES | C[C@@H](O)[C@@H](O)COc1ccccc1 |
| InChI | InChI=1S/C10H14O3/c1-8(11)10(12)7-13-9-5-3-2-4-6-9/h2-6,8,10-12H,7H2,1H3/t8-,10+/m1/s1 |
| InChIKey | XJBQYXCXGYSVBZ-SCZZXKLOSA-N |
| XLogP | 0.81 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |