About CID 142401703
CID 142401703 (PubChem CID 142401703) has the molecular formula C9H11BO
and a molecular weight of 146.00 g/mol.
Molecular Properties
| Compound Name | CID 142401703 |
| PubChem CID | 142401703 |
| Molecular Formula | C9H11BO |
| Molecular Weight | 146.00 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | — |
| SMILES | [B]C(C)COc1ccccc1 |
| InChI | InChI=1S/C9H11BO/c1-8(10)7-11-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3 |
| InChIKey | UIICIYVNXIMNJG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.00 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 142401703 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 142401703?
The IUPAC name of CID 142401703 (CID 142401703) is not available.
What is the SMILES notation for CID 142401703?
The canonical SMILES for CID 142401703 is [B]C(C)COc1ccccc1.
What is the InChIKey of CID 142401703?
The InChIKey is UIICIYVNXIMNJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BO/c1-8(10)7-11-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3.
What are the key properties of CID 142401703?
CID 142401703 has a molecular weight of 146.00 g/mol, XLogP of 2.04, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 142401703 is sourced from PubChem (CID 142401703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).