C17H21NO2 — CID 141461197
N,N-dimethyl-1,3-diphenoxypropan-2-amine (PubChem CID 141461197) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is N,N-dimethyl-1,3-diphenoxypropan-2-amine.
| Compound Name | N,N-dimethyl-1,3-diphenoxypropan-2-amine |
|---|---|
| PubChem CID | 141461197 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | N,N-dimethyl-1,3-diphenoxypropan-2-amine |
| SMILES | CN(C)C(COc1ccccc1)COc1ccccc1 |
| InChI | InChI=1S/C17H21NO2/c1-18(2)15(13-19-16-9-5-3-6-10-16)14-20-17-11-7-4-8-12-17/h3-12,15H,13-14H2,1-2H3 |
| InChIKey | JFMJHMCGFMKLIZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |