C10H12F2O — CID 53412752
2,3-difluorobutoxybenzene (PubChem CID 53412752) has the molecular formula C10H12F2O and a molecular weight of 186.20 g/mol. Its IUPAC name is 2,3-difluorobutoxybenzene.
| Compound Name | 2,3-difluorobutoxybenzene |
|---|---|
| PubChem CID | 53412752 |
| Molecular Formula | C10H12F2O |
| Molecular Weight | 186.20 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 2,3-difluorobutoxybenzene |
| SMILES | CC(F)C(F)COc1ccccc1 |
| InChI | InChI=1S/C10H12F2O/c1-8(11)10(12)7-13-9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3 |
| InChIKey | YDSPTZMKICAGMW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.20 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |