C10H12F2O2 — CID 67187369
4-(2,3-difluorobutoxy)phenol (PubChem CID 67187369) has the molecular formula C10H12F2O2 and a molecular weight of 202.20 g/mol. Its IUPAC name is 4-(2,3-difluorobutoxy)phenol.
| Compound Name | 4-(2,3-difluorobutoxy)phenol |
|---|---|
| PubChem CID | 67187369 |
| Molecular Formula | C10H12F2O2 |
| Molecular Weight | 202.20 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 4-(2,3-difluorobutoxy)phenol |
| SMILES | CC(F)C(F)COc1ccc(O)cc1 |
| InChI | InChI=1S/C10H12F2O2/c1-7(11)10(12)6-14-9-4-2-8(13)3-5-9/h2-5,7,10,13H,6H2,1H3 |
| InChIKey | IMMHMSJSTFJYIT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |