C12H19NO2 — CID 117242306
4-(2-amino-3,3-dimethylbutoxy)phenol (PubChem CID 117242306) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 4-(2-amino-3,3-dimethylbutoxy)phenol.
| Compound Name | 4-(2-amino-3,3-dimethylbutoxy)phenol |
|---|---|
| PubChem CID | 117242306 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 4-(2-amino-3,3-dimethylbutoxy)phenol |
| SMILES | CC(C)(C)C(N)COc1ccc(O)cc1 |
| InChI | InChI=1S/C12H19NO2/c1-12(2,3)11(13)8-15-10-6-4-9(14)5-7-10/h4-7,11,14H,8,13H2,1-3H3 |
| InChIKey | RSOLCYQNAMGEIO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |