C16H27NO — CID 43351797
1-(3-tert-butylphenoxy)-3,3-dimethylbutan-2-amine (PubChem CID 43351797) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is 1-(3-tert-butylphenoxy)-3,3-dimethylbutan-2-amine.
| Compound Name | 1-(3-tert-butylphenoxy)-3,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 43351797 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 1-(3-tert-butylphenoxy)-3,3-dimethylbutan-2-amine |
| SMILES | CC(C)(C)c1cccc(OCC(N)C(C)(C)C)c1 |
| InChI | InChI=1S/C16H27NO/c1-15(2,3)12-8-7-9-13(10-12)18-11-14(17)16(4,5)6/h7-10,14H,11,17H2,1-6H3 |
| InChIKey | YSXXODQUPBTSTC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |