C16H25FO — CID 170651711
1-tert-butyl-3-(2-fluoro-3,3-dimethylbutoxy)benzene (PubChem CID 170651711) has the molecular formula C16H25FO and a molecular weight of 252.37 g/mol. Its IUPAC name is 1-tert-butyl-3-(2-fluoro-3,3-dimethylbutoxy)benzene.
| Compound Name | 1-tert-butyl-3-(2-fluoro-3,3-dimethylbutoxy)benzene |
|---|---|
| PubChem CID | 170651711 |
| Molecular Formula | C16H25FO |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 1-tert-butyl-3-(2-fluoro-3,3-dimethylbutoxy)benzene |
| SMILES | CC(C)(C)c1cccc(OCC(F)C(C)(C)C)c1 |
| InChI | InChI=1S/C16H25FO/c1-15(2,3)12-8-7-9-13(10-12)18-11-14(17)16(4,5)6/h7-10,14H,11H2,1-6H3 |
| InChIKey | QZMSQXNNJOIJBK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |