C15H25NO — CID 62548208
3,3-dimethyl-1-(4-propylphenoxy)butan-2-amine (PubChem CID 62548208) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 3,3-dimethyl-1-(4-propylphenoxy)butan-2-amine.
| Compound Name | 3,3-dimethyl-1-(4-propylphenoxy)butan-2-amine |
|---|---|
| PubChem CID | 62548208 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 3,3-dimethyl-1-(4-propylphenoxy)butan-2-amine |
| SMILES | CCCc1ccc(OCC(N)C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H25NO/c1-5-6-12-7-9-13(10-8-12)17-11-14(16)15(2,3)4/h7-10,14H,5-6,11,16H2,1-4H3 |
| InChIKey | SWHSBVYVRIPXLT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |