C16H27NO3S — CID 65015481
3,3-dimethyl-2-[(4-propylphenoxy)methyl]butane-1-sulfonamide (PubChem CID 65015481) has the molecular formula C16H27NO3S and a molecular weight of 313.46 g/mol. Its IUPAC name is 3,3-dimethyl-2-[(4-propylphenoxy)methyl]butane-1-sulfonamide.
| Compound Name | 3,3-dimethyl-2-[(4-propylphenoxy)methyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 65015481 |
| Molecular Formula | C16H27NO3S |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 3,3-dimethyl-2-[(4-propylphenoxy)methyl]butane-1-sulfonamide |
| SMILES | CCCc1ccc(OCC(CS(N)(=O)=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H27NO3S/c1-5-6-13-7-9-15(10-8-13)20-11-14(16(2,3)4)12-21(17,18)19/h7-10,14H,5-6,11-12H2,1-4H3,(H2,17,18,19) |
| InChIKey | AKICTOJZSSNBSP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |